A3259412
3,4-Difluorobenzoic acid , 98% , 455-86-7
CAS NO.:455-86-7
Empirical Formula: C7H4F2O2
Molecular Weight: 158.1
MDL number: MFCD00011672
EINECS: 207-249-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB52.80 | In Stock |
|
| 25G | RMB177.60 | In Stock |
|
| 100G | RMB568.00 | In Stock |
|
| 500g | RMB2336.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-122 °C(lit.) |
| Boiling point: | 257.0±20.0 °C(Predicted) |
| Density | 1.3486 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.80±0.10(Predicted) |
| color | White |
| Water Solubility | slightly soluble in cold water |
| BRN | 2085848 |
| InChI | InChI=1S/C7H4F2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| InChIKey | FPENCTDAQQQKNY-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C(F)=C1 |
| CAS DataBase Reference | 455-86-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Difluorobenzoic acid(455-86-7) |
| EPA Substance Registry System | Benzoic acid, 3,4-difluoro- (455-86-7) |
Description and Uses
3,4-Difluoro-benzoic Acid is a useful synthetic intermediate. It is used to synthesize 2-arylbenzimidazole derivatives as melanin-concentrating hormone receptor 1 (MCH-R1) antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |



