A3261612
2,5-Difluorobenzyl bromide , 98% , 85117-99-3
Synonym(s):
α-Bromo-2,5-difluorotoluene
CAS NO.：85117-99-3
Empirical Formula: C7H5BrF2
Molecular Weight: 207.02
MDL number: MFCD00009897
EINECS: 285-651-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB73.60 | In Stock |
|
| 25G | RMB226.40 | In Stock |
|
| 100G | RMB837.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 28 °C |
| Density | 1.609 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 60 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.6090 |
| BRN | 7089248 |
| InChI | InChI=1S/C7H5BrF2/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
| InChIKey | ONWGSWNHQZYCFK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C=C1CBr |
| CAS DataBase Reference | 85117-99-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Difluorobenzyl bromide(85117-99-3) |
Description and Uses
2,5-Difluorobenzyl bromide has been used in the synthesis of:
- novel series of 4-aryl, 4-phenylsulfonyl cyclohexananone-derived γ-secretase inhibitors, for the potential treatment of Alzheimer′s disease
- sulfonamide, amide and acyclic amine derivatives
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F,C,Xi |
| Risk Statements | 11-34-22-36 |
| Safety Statements | 26-36/37/39-45-16 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
