A3261812
1,2-Dichloro-4-fluorobenzene , 98% , 1435-49-0
CAS NO.：1435-49-0
Empirical Formula: C6H3Cl2F
Molecular Weight: 164.99
MDL number: MFCD00018119
EINECS: 215-858-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB181.60 | In Stock |
|
| 100G | RMB482.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −1 °C(lit.) |
| Boiling point: | 172 °C(lit.) |
| Density | 1.403 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 148 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.403 |
| BRN | 1861278 |
| InChI | InChI=1S/C6H3Cl2F/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| InChIKey | QSDKXMVGRLVIQV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 1435-49-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Dichloro-4-fluorobenzene(1435-49-0) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P210e-P261-P280a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39-37 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29039990 |
