A3262212
2,3-Difluorobenzaldehyde , 98% , 2646-91-5
CAS NO.：2646-91-5
Empirical Formula: C7H4F2O
Molecular Weight: 142.1
MDL number: MFCD00010292
EINECS: 607-944-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB343.20 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-65 °C |
| Boiling point: | 64-65 °C/17 mmHg (lit.) |
| Density | 1.301 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 137 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| Specific Gravity | 1.301 |
| color | Clear pale yellow |
| Sensitive | Air Sensitive |
| BRN | 2961554 |
| InChI | InChI=1S/C7H4F2O/c8-6-3-1-2-5(4-10)7(6)9/h1-4H |
| InChIKey | WDBAXYQUOZDFOJ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC(F)=C1F |
| CAS DataBase Reference | 2646-91-5(CAS DataBase Reference) |
Description and Uses
2,3-Difluorobenzaldehyde was used in the synthesis of aminophosphine.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36/37 |
| RIDADR | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29130000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
