A3263012
3,4-Difluorobenzotrifluoride , 97% , 32137-19-2
CAS NO.：32137-19-2
Empirical Formula: C7H3F5
Molecular Weight: 182.09
MDL number: MFCD00077510
EINECS: 608-708-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.00 | In Stock |
|
| 5G | RMB212.80 | In Stock |
|
| 25g | RMB741.60 | In Stock |
|
| 100g | RMB2188.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C |
| Boiling point: | 103-104 °C |
| Density | 1.41 |
| refractive index | 1.388-1.392 |
| Flash point: | 103-104°C |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 1950149 |
| InChI | InChI=1S/C7H3F5/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H |
| InChIKey | MVCGQTYWLZSKSB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(C(F)(F)F)C=C1F |
| CAS DataBase Reference | 32137-19-2(CAS DataBase Reference) |
Description and Uses
3,4-Difluorobenzotrifluoride is a reactant in the preparation of arylacetonitriles.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi-F,F,Xi |
| Risk Statements | 36/37/38-11 |
| Safety Statements | 37/39-26-16-36 |
| RIDADR | 1993 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
