A3263212
2,4-Difluorotoluene , 99% , 452-76-6
CAS NO.:452-76-6
Empirical Formula: C7H6F2
Molecular Weight: 128.12
MDL number: MFCD00000332
EINECS: 207-211-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 10g | RMB64.00 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100g | RMB428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -35 °C |
| Boiling point: | 113-117 °C (lit.) |
| Density | 1.12 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 59 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 1.120 |
| BRN | 1931681 |
| InChI | InChI=1S/C7H6F2/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | MPXDAIBTYWGBSL-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1F |
| CAS DataBase Reference | 452-76-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4-Difluorotoluene(452-76-6) |
Description and Uses
2,4-Difluorotoluene was used in the synthesis of new hydrophobic isosteres of pyrimidines and purine nucleosides.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335-H225 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P403+P235-P501-P261-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,F+ |
| Risk Statements | 11 |
| Safety Statements | 16-29-33 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |





