A3264312
5,7-Dimethoxycoumarin , 98% , 487-06-9
Synonym(s):
5,7-Dimethoxycoumarin;Citropten;Limettin
CAS NO.:487-06-9
Empirical Formula: C11H10O4
Molecular Weight: 206.19
MDL number: MFCD00006870
EINECS: 207-646-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB119.20 | In Stock |
|
| 250MG | RMB243.20 | In Stock |
|
| 1G | RMB683.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-149 °C (lit.) |
| Boiling point: | 305.04°C (rough estimate) |
| Density | 1.2607 (rough estimate) |
| refractive index | 1.4570 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,5492 |
| Major Application | food and beverages |
| InChI | 1S/C11H10O4/c1-13-7-5-9(14-2)8-3-4-11(12)15-10(8)6-7/h3-6H,1-2H3 |
| InChIKey | NXJCRELRQHZBQA-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2C=CC(=O)Oc2c1 |
| LogP | 1.891 (est) |
| CAS DataBase Reference | 487-06-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2H-1-benzopyran-2-one, 5,7-dimethoxy-(487-06-9) |
| EPA Substance Registry System | 2H-1-Benzopyran-2-one, 5,7-dimethoxy- (487-06-9) |
Description and Uses
photosensitizing agent




