A3265212
3,5-Difluorobenzonitrile , ≥98.0% , 64248-63-1
CAS NO.:64248-63-1
Empirical Formula: C7H3F2N
Molecular Weight: 139.1
MDL number: MFCD00010311
EINECS: 264-752-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB151.20 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-86 °C(lit.) |
| Boiling point: | 160 °C |
| Density | 1.2490 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Insoluble[in water] |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2082206 |
| InChI | InChI=1S/C7H3F2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
| InChIKey | CQXZSEXZQVKCHW-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 64248-63-1(CAS DataBase Reference) |
Description and Uses
The vibrational wavenumbers, geometry and various thermodynamic parameters were studied for 3,5-difluorobenzonitrile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39-36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






