A3266512
2,6-Difluorotoluene , 99% , 443-84-5
CAS NO.:443-84-5
Empirical Formula: C7H6F2
Molecular Weight: 128.12
MDL number: MFCD00043898
EINECS: 623-587-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB431.20 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 112 °C/740 mmHg (lit.) |
| Density | 1.129 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 50 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| Specific Gravity | 1.129 |
| color | Colorless to Light yellow |
| BRN | 1932656 |
| InChI | InChI=1S/C7H6F2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| InChIKey | MZLSNIREOQCDED-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1C |
| CAS DataBase Reference | 443-84-5(CAS DataBase Reference) |
Description and Uses
2,6-Difluorotoluene was used to generate jet-cooled 2,6-difluorobenzyl radical and to investigate its vibronically resolved emission spectra.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,F+ |
| Risk Statements | 11 |
| Safety Statements | 16-29-33 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




