A3266612
(R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol , 98% , 65283-60-5
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB135.20 | In Stock |
|
| 1G | RMB233.60 | In Stock |
|
| 5G | RMB776.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-199 °C(lit.) |
| alpha | -48 º (c=1.8, THF) |
| Boiling point: | 546.2±45.0 °C(Predicted) |
| Density | 1.5428 (rough estimate) |
| refractive index | 1.4947 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 7.78±0.50(Predicted) |
| color | White to Light yellow to Light orange |
| optical activity | [α]20/D 49°, c = 1.8 in acetic acid |
| InChI | 1S/C20H12Br2O2/c21-13-3-5-15-11(9-13)1-7-17(23)19(15)20-16-6-4-14(22)10-12(16)2-8-18(20)24/h1-10,23-24H |
| InChIKey | OORIFUHRGQKYEV-UHFFFAOYSA-N |
| SMILES | Brc1cc2c(c(c(cc2)O)c3c4c(cc(cc4)Br)ccc3O)cc1 |
| CAS DataBase Reference | 65283-60-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
