A3267612
1,4-Dibromo-2-fluorobenzene , 98% , 1435-52-5
CAS NO.:1435-52-5
Empirical Formula: C6H3Br2F
Molecular Weight: 253.89
MDL number: MFCD00010603
EINECS: 629-432-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB84.80 | In Stock |
|
| 100G | RMB238.40 | In Stock |
|
| 500g | RMB1152.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 33-36 °C (lit.) |
| Boiling point: | 216 °C (lit.) |
| Density | 2.0491 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| Flash point: | 215 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorles to Yellow to Orange |
| Water Solubility | Insoluble in water. |
| FreezingPoint | 32.0 to 34.0 ℃ |
| BRN | 3236451 |
| InChI | InChI=1S/C6H3Br2F/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | WNSNPGHNIJOOPM-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 1435-52-5(CAS DataBase Reference) |
Description and Uses
1,4-Dibromo-2-fluorobenzene was used in preparation of 1,4-bis(2-hydroxy-2-methyl-3-butynyl)-2-fluorobenzene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







