A3272012
4,4''-Diamino-p-terphenyl , 95% , 3365-85-3
CAS NO.：3365-85-3
Empirical Formula: C18H16N2
Molecular Weight: 260.33
MDL number: MFCD00051532
EINECS: 677-188-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB88.00 | In Stock |
|
| 5G | RMB360.80 | In Stock |
|
| 25G | RMB1386.40 | In Stock |
|
| 100g | RMB4938.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 242-244°C |
| Boiling point: | 484.2±25.0 °C(Predicted) |
| Density | 1.159±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Tetrahydrofuran,Acetone |
| pka | 4.59±0.10(Predicted) |
| Appearance | White to light yellow Solid |
| BRN | 2120295 |
| InChI | InChI=1S/C18H16N2/c19-17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(20)12-8-16/h1-12H,19-20H2 |
| InChIKey | QBSMHWVGUPQNJJ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C3=CC=C(N)C=C3)C=C2)=CC=C(N)C=C1 |
Description and Uses
4,4''-Diamino-p-terphenyl can be used to make selective hydrogen sensors that have high sensitivity, low consumption, and no cross-sensitivity to methane and ethane even at their operating temperatures and higher. Moreover, it is also used for studies of Symmetry breakdown of 4,4″-diamino-p-terphenyl on a Cu(111) surface by lattice mismatch[1-2].
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H350-H302-H341 |
| Precautionary statements | P301+P312a-P501a-P201-P202-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P308+P313-P405-P501 |
| Risk Statements | 20/21/22-45 |
| Safety Statements | 45-53 |
| RIDADR | 2811 |
| PackingGroup | II |
| HS Code | 29215900 |
