A3274512
2,5-Diaminotoluene sulfate , 98% , 615-50-9
Synonym(s):
2,5-Toluenediamine sulfate;2-Methyl-p-phenylenediamine sulfate salt
CAS NO.:615-50-9
Empirical Formula: C7H12N2O4S
Molecular Weight: 220.24
MDL number: MFCD00013003
EINECS: 210-431-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Density | 1366[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 2-8°C |
| solubility | 9.6g/l |
| pka | 6.39[at 20 ℃] |
| form | powder to crystal |
| color | White to Light yellow to Light red |
| PH | 1.8 (9.6g/l, H2O, 20℃) |
| Water Solubility | soluble |
| BRN | 3755478 |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C7H10N2.H2O4S/c1-5-4-6(8)2-3-7(5)9;1-5(2,3)4/h2-4H,8-9H2,1H3;(H2,1,2,3,4) |
| InChIKey | KZTWOUOZKZQDMN-UHFFFAOYSA-N |
| SMILES | CC1C=C(N)C=CC=1N.S(O)(O)(=O)=O |
| LogP | 0.74 at 20℃ |
| CAS DataBase Reference | 615-50-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Benzenediamine, 2-methyl-, sulfate (1:1) (615-50-9) |
Description and Uses
2,5-Diaminotoluene sulfate is a primary intermediate in various permanent hair dyes.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H317-H411 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | T,N |
| Risk Statements | 20/21-25-43-51/53 |
| Safety Statements | 24-37-45-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XT0525000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29215119 |
| Hazardous Substances Data | 615-50-9(Hazardous Substances Data) |




