A3274612
2,3:5,6-Di-O-isopropylidene-α-D-mannofuranose , 98% , 14131-84-1
Synonym(s):
D -Mannose diacetonide
CAS NO.:14131-84-1
Empirical Formula: C12H20O6
Molecular Weight: 260.28
MDL number: MFCD00134206
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB259.20 | In Stock |
|
| 25G | RMB760.00 | In Stock |
|
| 100g | RMB1327.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-126 °C (dec.)(lit.) |
| alpha | 21 º (c=1, acetone) |
| Boiling point: | 363.54°C (rough estimate) |
| Density | 1.2377 (rough estimate) |
| refractive index | 24 ° (C=1, Acetone) |
| storage temp. | 2-8°C |
| solubility | Acetone (Slightly, Sonicated), Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.97±0.60(Predicted) |
| form | Powder |
| color | White to Off-white |
| optical activity | [α]20/D +23°, c = 1 in acetone |
| Water Solubility | Soluble in acetone, methanol, water. |
| Sensitive | Hygroscopic |
| BRN | 84382 |
| InChI | InChI=1/C12H20O6/c1-11(2)14-5-6(16-11)7-8-9(10(13)15-7)18-12(3,4)17-8/h6-10,13H,5H2,1-4H3/t6-,7-,8+,9+,10+/s3 |
| InChIKey | JWWCLCNPTZHVLF-QEOBICLWNA-N |
| SMILES | [C@@H]12OC(C)(C)O[C@@H]1[C@@H](O)O[C@]2([H])[C@]1([H])OC(C)(C)OC1 |&1:0,6,7,10,12,r| |
Description and Uses
2,3:5,6-Di-O-isopropylidene-alpha-D-mannofuranose is used in the syntheses of ovalicin1 and of the sugar core of hikizimycin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| F | 3-21 |
| HS Code | 29400090 |





