A3278112
Dextran sulfate sodium salt , M.W5,000 , 9011-18-1
Synonym(s):
Dextran Sulfate, Sodium Salt, Molecular Biology Grade - CAS 9011-18-1 - Calbiochem
CAS NO.:9011-18-1
Empirical Formula: (C6H7Na3O14S3)n
Molecular Weight:
MDL number: MFCD00081551
EINECS: 618-471-1
| Pack Size | Price | Stock | Quantity |
| 10G | RMB141.60 | In Stock |
|
| 50G | RMB507.20 | In Stock |
|
| 100G | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | (Decomposes on heating.) |
| storage temp. | room temp |
| solubility | H2O: 100 mg/mL |
| form | powder |
| color | White to off-white |
| PH | pH(50g/l, 25℃)4.5~8.0 |
| biological source | synthetic |
| optical activity | [α]20/D 75 to 105 ° |
| Water Solubility | Soluble in water. |
| Merck | 2951 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| InChIKey | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C1=CC=C(N)C=C1 |
| EPA Substance Registry System | Dextran, hydrogen sulfate, sodium salt (9011-18-1) |
Description and Uses
Clinical studies indicate a possible capacity of dextran sulfate to reduce edema. It is cited as a binder and skin conditioner.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-37/39-24/25 |
| WGK Germany | 2 |
| RTECS | HH9290000 |
| F | 3-10 |
| TSCA | Yes |
| HS Code | 39139000 |


