A3279112
4,5-Dichloro-3-hydroxypyridazine , 98% , 932-22-9
Synonym(s):
4,5-Dichloro-3(2H)-pyridazinone
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100G | RMB307.20 | In Stock |
|
| 500g | RMB1159.20 | In Stock |
|
| 1kg | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C(lit.) |
| Density | 1.76±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.39±0.60(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| BRN | 120959 |
| InChI | InChI=1S/C4H2Cl2N2O/c5-2-1-7-8-4(9)3(2)6/h1H,(H,8,9) |
| InChIKey | VJWXIRQLLGYIDI-UHFFFAOYSA-N |
| SMILES | C1(=O)NN=CC(Cl)=C1Cl |
| CAS DataBase Reference | 932-22-9(CAS DataBase Reference) |
Description and Uses
4,5-Dichloro-3(2H)-pyridazinone is used as a new labelled substituted pyridazinone with tuberculostatic action.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | UR6182000 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |






