PRODUCT Properties
| Melting point: | 136-138 °C (lit.) |
| Boiling point: | 275 °C (10 mmHg) |
| Density | 1,2 g/cm3 |
| refractive index | 1.5400 (estimate) |
| Flash point: | 223 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| InChI | 1S/C20H14O4/c21-19(23-17-10-3-1-4-11-17)15-8-7-9-16(14-15)20(22)24-18-12-5-2-6-13-18/h1-14H |
| InChIKey | FHESUNXRPBHDQM-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c2cccc(c2)C(=O)Oc3ccccc3 |
| CAS DataBase Reference | 744-45-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenyl isophthalate(744-45-6) |
| EPA Substance Registry System | Diphenyl isophthalate (744-45-6) |
Description and Uses
Diphenyl isophthalate may be employed for the preparation of:
- poly(benzoxazole) (PBO) precursor, poly(o-hydroxyamide)
- 3[4″-hydroxybenzoyl)-4′-hydroxybenzophenone
- poly(o-hydroxyamide), via polycondensation of 2,2-bis(3-amino-4-hydroxyphenyl)hexafluoropropane in 1-methyl-2-pyrrolidinone
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |



