A3280012
3,5-Di-tert-butyltoluene , 98% , 15181-11-0
CAS NO.:15181-11-0
Empirical Formula: C15H24
Molecular Weight: 204.35
MDL number: MFCD00026300
EINECS: 239-230-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB71.20 | In Stock |
|
| 5ML | RMB75.20 | In Stock |
|
| 25ML | RMB228.80 | In Stock |
|
| 25G | RMB392.00 | In Stock |
|
| 100ML | RMB851.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31-32 °C (lit.) |
| Boiling point: | 244 °C (lit.) |
| Density | 0.86 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 196 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| BRN | 2043032 |
| InChI | 1S/C15H24/c1-11-8-12(14(2,3)4)10-13(9-11)15(5,6)7/h8-10H,1-7H3 |
| InChIKey | WIXDSJRJFDWTNY-UHFFFAOYSA-N |
| SMILES | Cc1cc(cc(c1)C(C)(C)C)C(C)(C)C |
Description and Uses
3,5-Di-tert-butyltoluene was used in the synthesis of 3,5-di-tert-butyl(bromomethyl)benzene. It was also used in the synthesis of di-tert-butylbenzoic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 2902900000 |
| Storage Class | 11 - Combustible Solids |







