A3280912
2,6-Dimethoxyaniline , 97% , 2734-70-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.52 | In Stock |
|
| 5G | RMB162.72 | In Stock |
|
| 25G | RMB584.80 | In Stock |
|
| 100g | RMB2311.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-74 |
| Boiling point: | 254℃ |
| Density | 1.096 |
| refractive index | 1.4770 (estimate) |
| Flash point: | 116℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 4.48±0.10(Predicted) |
| color | White to Gray to Brown |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H11NO2/c1-10-6-4-3-5-7(11-2)8(6)9/h3-5H,9H2,1-2H3 |
| InChIKey | HQBJSEKQNRSDAZ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(OC)C=CC=C1OC |
| CAS DataBase Reference | 2734-70-5(CAS DataBase Reference) |
Description and Uses
2,6-Dimethylaniline degradation by Fenton process has been studied in depth for the purpose of learning more about the reactions involved in the oxidation of 2,6-dimethylaniline under various reaction conditions. Using a previously developed gas chromatographic-mass spectrometric assay, hemoglobin adducts of 2,6-dimethylaniline were detected covalently bound to rat hemoglobin after administration of either 2,6-dimethylaniline or lidocaine.
Safety
| Symbol(GHS) |    GHS07,GHS06,GHS08 |
| Signal word | Warning |
| Hazard statements | H311-H332-H373-H302-H315-H319 |
| Precautionary statements | P280h-P302+P352-P309-P310-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi,T |
| Risk Statements | 20/21/22-36/37/38-36-33 |
| Safety Statements | 26-36/37/39-36/37-28 |
| RIDADR | UN2811 |
| Hazard Note | Toxic/Irritant |
| TSCA | N |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
