PRODUCT Properties
| Boiling point: | 70-72°C 56mm |
| Density | 1.221 |
| refractive index | 1.4570 to 1.4620 |
| Flash point: | 61°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.2350 |
| InChI | InChI=1S/C7H6F2O/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,1H3 |
| InChIKey | IOBWAHRFIPQEQL-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1OC |
| CAS DataBase Reference | 437-82-1(CAS DataBase Reference) |
Description and Uses
2,6-Difluoroanisole is an ether derivative and can be used as an organic reagent.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | 1993 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2909309090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
