A3283412
1,2-Dibromotetrafluorobenzene , 97% , 827-08-7
CAS NO.：827-08-7
Empirical Formula: C6Br2F4
Molecular Weight: 307.87
MDL number: MFCD00039209
EINECS: 212-564-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB281.60 | In Stock |
|
| 5G | RMB870.40 | In Stock |
|
| 25g | RMB2091.04 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 12°C |
| Boiling point: | 198 °C (lit.) |
| Density | 2.238 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 210 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 2.238 |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C6Br2F4/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | IPLUWQPTPKNBRD-UHFFFAOYSA-N |
| SMILES | C1(Br)=C(F)C(F)=C(F)C(F)=C1Br |
| CAS DataBase Reference | 827-08-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2-dibromo-3,4,5,6-tetrafluoro-(827-08-7) |
Description and Uses
1,2-Dibromotetrafluorobenzene is used as medicine and liquid crystal material intermediate. It helps in the synthesis of diphenyl(o-bromotetrafluorophenyl)phosphine and 2,3,4,5tetrafluorothioanisole.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29036990 |
