A3284112
Dibenzyl N,N-Diisopropylphosphoramidite , 98% , 108549-23-1
CAS NO.:108549-23-1
Empirical Formula: C20H28NO2P
Molecular Weight: 345.42
MDL number: MFCD00191988
EINECS: 629-628-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB56.00 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB539.20 | In Stock |
|
| 100G | RMB1856.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 130 °C0.55 mm Hg(lit.) |
| Density | 1.028 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 158 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in chloroform. |
| pka | 4.50±0.70(Predicted) |
| form | Oil |
| color | Clear Colourless |
| Water Solubility | THF: soluble(lit.) acetonitrile: soluble(lit.) cold water: insoluble(lit.) dichloromethane: soluble(lit.) |
| Sensitive | Moisture Sensitive |
| BRN | 3616864 |
| InChI | InChI=1S/C20H28NO2P/c1-17(2)21(18(3)4)24(22-15-19-11-7-5-8-12-19)23-16-20-13-9-6-10-14-20/h5-14,17-18H,15-16H2,1-4H3 |
| InChIKey | ANPWLBTUUNFQIO-UHFFFAOYSA-N |
| SMILES | P(N(C(C)C)C(C)C)(OCC1=CC=CC=C1)OCC1=CC=CC=C1 |
| CAS DataBase Reference | 108549-23-1(CAS DataBase Reference) |
Description and Uses
Dibenzyl diisopropylphosphoramidite is a versatile phosphitylating agent.
Dibenzyl N,N-diisopropylphosphoramidite may be used for the preparation of phosphopeptides. It is used for the synthesis of a GDP (guanosine diphosphate) analog, SML-8-73-1. It is useful for nucleotide coupling.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |




