A3284312
1,3-Dibromo-5-fluorobenzene , 98% , 1435-51-4
CAS NO.：1435-51-4
Empirical Formula: C6H3Br2F
Molecular Weight: 253.89
MDL number: MFCD00061119
EINECS: 215-860-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB332.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 204-206 °C/768 mmHg (lit.) |
| Density | 2.018 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow to Green |
| Specific Gravity | 2.02 |
| BRN | 2353462 |
| InChI | InChI=1S/C6H3Br2F/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | ASWYHZXKFSLNLN-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=CC(Br)=C1 |
| CAS DataBase Reference | 1435-51-4(CAS DataBase Reference) |
Description and Uses
1,3-Dibromo-5-fluorobenzene may be used in the preparation of ligand 5-fluoro-1,3-di(2-pyridyl)benzene, by a Stille reaction with 2-(tri-nbutylstannyl)pyridine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
