A3285212
2,4-Difluorobenzylamine , 98% , 72235-52-0
CAS NO.:72235-52-0
Empirical Formula: C7H7F2N
Molecular Weight: 143.13
MDL number: MFCD00010142
EINECS: 276-502-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100g | RMB371.20 | In Stock |
|
| 500g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255-256 °C(Solv: N,N-dimethylformamide (68-12-2)) |
| Boiling point: | 82-84 °C (15 mmHg) |
| Density | 1.204 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 155 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 8.58±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.204 |
| Sensitive | Air Sensitive |
| BRN | 3539259 |
| InChI | InChI=1S/C7H7F2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2 |
| InChIKey | QDZZDVQGBKTLHV-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(F)C=C1F |
| CAS DataBase Reference | 72235-52-0(CAS DataBase Reference) |
Description and Uses
2,4-Difluorobenzylamine has been used in the synthesis of βAla–Aib(N-fluoroarylmethyl)], nonpolar nucleobase dipeptide via Ugi four-component condensation reaction.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45-25 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







