A3285812
2,6-Difluorobenzyl alcohol , 97% , 19064-18-7
CAS NO.：19064-18-7
Empirical Formula: C7H6F2O
Molecular Weight: 144.12
MDL number: MFCD00004603
EINECS: 242-792-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB128.00 | In Stock |
|
| 100G | RMB454.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168.5-169 °C |
| Boiling point: | 88 °C |
| Density | 1.3 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 192 °F |
| storage temp. | 2-8°C |
| pka | 13.41±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.300 |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 2501536 |
| InChI | InChI=1S/C7H6F2O/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4H2 |
| InChIKey | LVICICZQETYOGS-UHFFFAOYSA-N |
| SMILES | C1(CO)=C(F)C=CC=C1F |
| CAS DataBase Reference | 19064-18-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Difluorobenzyl alcohol(19064-18-7) |
Description and Uses
2,6-Difluorobenzyl alcohol is used to get 2-(bromomethyl)-1,3-difluorobenzene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H227-H315-H319 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 2906290090 |
