PRODUCT Properties
Melting point: | 33-35°C |
Boiling point: | 70°C 5mm |
Density | 1.033±0.06 g/cm3(Predicted) |
Flash point: | 33 °C |
storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
form | powder to lump to clear liquid |
color | White or Colorless to Light yellow |
InChI | InChI=1S/C9H11Cl/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,6H2,1-2H3 |
InChIKey | HPVRFWQMBYLJRL-UHFFFAOYSA-N |
SMILES | C1(C)=CC=CC(C)=C1CCl |
CAS DataBase Reference | 5402-60-8(CAS DataBase Reference) |
Description and Uses
2,6-Dimethylbenzyl chloride (2,6-DMBC) can be used for spectroscopic studies. 2,6-DMBC as a precursor, with the addition of a large amount of the inert carrier gas He, can be used to generate jet-cooled 2,6-dimethylbenzyl radicals and used in their vibrational spectroscopic studies[1]. 2,6-DMBC can also be used in chemical manufacturing and as a reagent for reactions. The main chemical activity of 2,6-DMBC involves an electrophilic aromatic substitution reaction, where the chlorine atom replaces the hydrogen atom on the aromatic ring, a process that is usually accelerated by a This process is usually accelerated by a catalyst such as copper(II) chloride.
Safety
Symbol(GHS) | ![]() GHS05 |
Signal word | Danger |
Hazard statements | H290-H314 |
Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
Hazard Codes | Xi |
Risk Statements | 36/37/38 |
Safety Statements | 26-36/37/39 |
RIDADR | 3261 |
HazardClass | IRRITANT, LACHRYMATOR |
HS Code | 2916399090 |