A3286812
2,4-Difluorophenylacetic acid , 99% , 81228-09-3
CAS NO.：81228-09-3
Empirical Formula: C8H6F2O2
Molecular Weight: 172.13
MDL number: MFCD00009999
EINECS: 279-709-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB248.00 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-118 °C (lit.) |
| Boiling point: | 219°C (rough estimate) |
| Density | 1.3010 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.98±0.10(Predicted) |
| form | Powder |
| color | White |
| BRN | 3649727 |
| InChI | InChI=1S/C8H6F2O2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12) |
| InChIKey | QPKZIGHNRLZBCL-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(F)C=C1F |
| CAS DataBase Reference | 81228-09-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4-Difluorophenylacetic acid(81228-09-3) |
Description and Uses
2,4-Difluorophenylacetic acid has been used in the synthesis of nonpolar peptide nucleic acid monomers containing fluoroaromatics (F-PNA).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
