A3288612
2,4-Dichlorobenzenesulfonyl Chloride , 98% , 16271-33-3
CAS NO.:16271-33-3
Empirical Formula: C6H3Cl3O2S
Molecular Weight: 245.51
MDL number: MFCD00052712
EINECS: 628-025-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5G | RMB49.60 | In Stock |
|
| 25G | RMB216.00 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-58 °C (lit.) |
| Boiling point: | 114-115°C/0.1mm |
| Density | 1.636±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to light beige |
| Sensitive | Moisture Sensitive |
| BRN | 2806192 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-2-6(5(8)3-4)12(9,10)11/h1-3H |
| InChIKey | FDTPBIKNYWQLAE-UHFFFAOYSA-N |
| SMILES | Clc1ccc(c(Cl)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 16271-33-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenesulfonyl chloride, 2,4-dichloro-(16271-33-3) |
Description and Uses
2,4-Dichlorobenzenesulfonyl chloride may be used in the preparation of 2,4-dichlorothiophenol.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DB8927500 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




