A3290112
1,3-Dimethyluric acid , 98% , 944-73-0
Synonym(s):
1,3-Dimethyl-2,6,8-trihydroxypurine;1,3-Dimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione;Oxytheophylline
CAS NO.：944-73-0
Empirical Formula: C7H8N4O3
Molecular Weight: 196.16
MDL number: MFCD00009740
EINECS: 213-410-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB240.00 | In Stock |
|
| 250MG | RMB369.60 | In Stock |
|
| 1g | RMB1095.20 | In Stock |
|
| 5g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C(lit.) |
| Boiling point: | 333.04°C (rough estimate) |
| Density | 1.4375 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | 1 M NH4OH: soluble50mg/mL, clear to slightly hazy, colorless to faintly yellow |
| pka | 5.61±0.50(Predicted) |
| form | Solid |
| color | Light Yellow |
| InChI | InChI=1S/C7H8N4O3/c1-10-4-3(8-6(13)9-4)5(12)11(2)7(10)14/h1-2H3,(H2,8,9,13) |
| InChIKey | OTSBKHHWSQYEHK-UHFFFAOYSA-N |
| SMILES | N1C2=C(N(C)C(=O)N(C)C2=O)NC1=O |
| CAS DataBase Reference | 944-73-0 |
Description and Uses
1,3-Dimethyluric Acid, is a metabolite of Caffeine (C080100), that is shown to have some of Its similar effects.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | UP0783700 |
| HS Code | 29339900 |
