A3290212
2,2-Dimethylthiazolidine , 97% , 19351-18-9
CAS NO.:19351-18-9
Empirical Formula: C5H11NS
Molecular Weight: 117.21
MDL number: MFCD00014488
EINECS: 242-980-4
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB31.20 | In Stock |
|
| 25ML | RMB76.80 | In Stock |
|
| 100ml | RMB196.00 | In Stock |
|
| 500ML | RMB1298.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 61 °C / 15mmHg |
| Density | 1,02 g/cm3 |
| vapor pressure | 2.01hPa at 25℃ |
| refractive index | 1.5100-1.5140 |
| Flash point: | 55°C |
| storage temp. | 2-8°C(protect from light) |
| form | clear liquid |
| pka | 8.97±0.40(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C5H11NS/c1-5(2)6-3-4-7-5/h6H,3-4H2,1-2H3 |
| InChIKey | SNPQRYOQWLOTFA-UHFFFAOYSA-N |
| SMILES | S1CCNC1(C)C |
| LogP | 1.38 |
| CAS DataBase Reference | 19351-18-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,2-Dimethylthiazolidine(19351-18-9) |
| EPA Substance Registry System | Thiazolidine, 2,2-dimethyl- (19351-18-9) |
Description and Uses
2,2-Dimethylthiazolidine is a promising radioprotectants.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501 |
| Hazard Codes | T |
| Risk Statements | 10-36/37/38-25 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | 1993 |
| WGK Germany | WGK 3 |
| RTECS | XJ5565700 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2934999090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
| Toxicity | mouse,LD50,parenteral,500mg/kg (500mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 433, 1982. |






