A3295012
3,5-Difluoroaniline , 98% , 372-39-4
CAS NO.：372-39-4
Empirical Formula: C6H5F2N
Molecular Weight: 129.11
MDL number: MFCD00007763
EINECS: 206-752-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.80 | In Stock |
|
| 5G | RMB158.40 | In Stock |
|
| 25G | RMB464.00 | In Stock |
|
| 100g | RMB1440.00 | In Stock |
|
| 500G | RMB4372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-41 °C (lit.) |
| Boiling point: | 80°C 20mm |
| Density | 1,295 g/cm3 |
| refractive index | 1,512-1,514 |
| Flash point: | 167 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | Low Melting Solid |
| pka | 2.57±0.10(Predicted) |
| color | White to yellow |
| BRN | 2802286 |
| InChI | InChI=1S/C6H5F2N/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2 |
| InChIKey | KQOIBXZRCYFZSO-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 372-39-4(CAS DataBase Reference) |
| EPA Substance Registry System | 3,5-Difluoroaniline (372-39-4) |
Description and Uses
3,5-Difluoroaniline has been used in the preparation of 3,5-difluorodimethylaniline.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332-H335-H302+H312+H332-H301+H311+H331-H315-H319 |
| Precautionary statements | P304+P340-P305+P351+P338-P501a-P261-P264-P270-P271-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501-P280 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 28-36/37/39-26-36 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10-23 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
