A3296712
4,6-Dihydroxy-2-methylpyrimidine , 99% , 40497-30-1
Synonym(s):
2-Methyl-4,6-pyrimidinediol
CAS NO.:40497-30-1
Empirical Formula: C5H6N2O2
Molecular Weight: 126.11
MDL number: MFCD00006104
EINECS: 254-941-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB158.40 | In Stock |
|
| 500G | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 234.21°C (rough estimate) |
| Density | 1.3541 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in sodium hydroxide. |
| form | powder to crystal |
| pka | 9.42±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 115646 |
| InChI | InChI=1S/C5H6N2O2/c1-3-6-4(8)2-5(9)7-3/h2H2,1H3,(H,6,7,8,9) |
| InChIKey | GNVCKXIBBIIFPE-UHFFFAOYSA-N |
| SMILES | C1(C)NC(=O)CC(=O)N=1 |
| CAS DataBase Reference | 40497-30-1(CAS DataBase Reference) |
Description and Uses
4,6-Dihydroxy-2-methylpyrimidine is used in the preparation of 4,6-dichloro-2-methyl-pyrimidine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29335995 |
| Storage Class | 13 - Non Combustible Solids |





