A3297812
2,7-Dibromocarbazole , 98% , 136630-39-2
Synonym(s):
2,7-Dibromocarbazole
CAS NO.：136630-39-2
Empirical Formula: C12H7Br2N
Molecular Weight: 325
MDL number: MFCD09033507
EINECS: 679-869-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25G | RMB439.20 | In Stock |
|
| 100G | RMB1575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230.0 to 234.0 °C |
| Boiling point: | 459.0±25.0 °C(Predicted) |
| Density | 1.930±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 15.13±0.30(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C12H7Br2N/c13-7-1-3-9-10-4-2-8(14)6-12(10)15-11(9)5-7/h1-6,15H |
| InChIKey | QPTWWBLGJZWRAV-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(Br)=C2)C2=C1C=C(Br)C=C2 |
Description and Uses
2,7-dibromocarbazole, also known as 2,7-dibromo-9H-carbazole, is a building block for the synthesis of small molecules of carbazole series or carbazole back-boned polymers in the application of OFETs, OLEDs, PLEDs and OPVs.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
![2,7-Dibromo-4,4,9,9-tetrakis(4-hexylphenyl)-4,9-dihydro-s-indaceno[1,2-b:5,6-b'']dithiophene](https://img.chemicalbook.com/CAS/20210111/GIF/1049034-71-0.gif)
