A3297912
3,5-Dibromotoluene , ≥98.0% , 1611-92-3
CAS NO.：1611-92-3
Empirical Formula: C7H6Br2
Molecular Weight: 249.93
MDL number: MFCD00013528
EINECS: 605-248-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB197.60 | In Stock |
|
| 500g | RMB968.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C (lit.) |
| Boiling point: | 246 °C (lit.) |
| Density | 1.8246 (rough estimate) |
| refractive index | 1.6075 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Yellow to Orange |
| BRN | 1928685 |
| InChI | InChI=1S/C7H6Br2/c1-5-2-6(8)4-7(9)3-5/h2-4H,1H3 |
| InChIKey | DPKKOVGCHDUSAI-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C)=CC(Br)=C1 |
| CAS DataBase Reference | 1611-92-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-dibromo-5-methyl-(1611-92-3) |
Description and Uses
3,5-Dibromotoluene was used in the preparation of 3,5-bis(diphenylphosphinothioyl)toluene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
