A3298512
2-(3,4-Dimethoxyphenyl)ethanol , >98.0%(GC) , 7417-21-2
Synonym(s):
3,4-Dimethoxybenzeneethanol;3,4-Dimethoxyphenethyl alcohol;Homoveratryl alcohol
CAS NO.：7417-21-2
Empirical Formula: C10H14O3
Molecular Weight: 182.22
MDL number: MFCD00002894
EINECS: 231-032-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB96.80 | In Stock |
|
| 25G | RMB316.80 | In Stock |
|
| 50g | RMB487.20 | In Stock |
|
| 100g | RMB875.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-49 °C(lit.) |
| Boiling point: | 172-174 °C17 mm Hg(lit.) |
| Density | 1.0966 (rough estimate) |
| refractive index | 1.4880 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 14.80±0.10(Predicted) |
| color | Light yellow |
| BRN | 909742 |
| InChI | InChI=1S/C10H14O3/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | SRQAJMUHZROVHW-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 7417-21-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Dimethoxyphenethyl alcohol(7417-21-2) |
Description and Uses
2-(3,4-Dimethoxyphenyl)ethanol (Homoveratryl alcohol) was used as a model compound in the delignification mechanism studies of Mn(III)-substituted polyoxometalates (MSP).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29094990 |
