A3302712
3,5-Dimethyl-4-nitropyridine-2-methanol , 98% , 149082-03-1
CAS NO.:149082-03-1
Empirical Formula: C8H10N2O3
Molecular Weight: 182.18
MDL number: MFCD03426035
EINECS: 604-675-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB188.80 | In Stock |
|
| 100G | RMB616.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-70 °C (lit.) |
| Boiling point: | 349.7±37.0 °C(Predicted) |
| Density | 1.293±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 12.97±0.10(Predicted) |
| color | White to Gray to Brown |
| InChI | 1S/C8H10N2O3/c1-5-3-9-7(4-11)6(2)8(5)10(12)13/h3,11H,4H2,1-2H3 |
| InChIKey | KBCDOXSSYLFMHH-UHFFFAOYSA-N |
| SMILES | Cc1cnc(CO)c(C)c1[N+]([O-])=O |
| CAS DataBase Reference | 149082-03-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







