A3304712
3,5-Difluoro-4-hydroxybenzaldehyde , 99% , 118276-06-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB68.00 | In Stock |
|
| 1G | RMB204.00 | In Stock |
|
| 5g | RMB851.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-124°C |
| Boiling point: | 198.5±35.0 °C(Predicted) |
| Density | 1.464±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.27±0.23(Predicted) |
| color | White to Pale Yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C7H4F2O2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H |
| InChIKey | SKOYTQILPMNZQO-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(F)=C(O)C(F)=C1 |
| CAS DataBase Reference | 118276-06-5(CAS DataBase Reference) |
Description and Uses
3,5-Difluoro-4-hydroxybenzaldehyde is used in the preparation of (Z)-2,6- difluoro-((2-methyl-5-oxooxazol-4(5H)-ylidene)methyl)phenylacetate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2913000090 |





