A3305912
(1S,6S)-2,8-Diazabicyclo[4.3.0]nonane , 98% , 151213-40-0
Synonym(s):
(4aS,7aS)-Octahydro-1H-pyrrolo[3,4-b]pyridine
CAS NO.:151213-40-0
Empirical Formula: C7H14N2
Molecular Weight: 126.2
MDL number: MFCD04116298
EINECS: 604-778-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB135.20 | In Stock |
|
| 5G | RMB519.20 | In Stock |
|
| 25G | RMB2399.20 | In Stock |
|
| 100g | RMB6239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 198℃ |
| Density | 0.950 |
| refractive index | n20/D1.515 |
| Flash point: | 87℃ |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly), Water (Sparingly) |
| form | Oil |
| pka | 11.11±0.20(Predicted) |
| color | Clear Colourless to Pale Yellow |
| optical activity | [α]22/D -4.0°, c =0.5 in chloroform |
| InChI | InChI=1S/C7H14N2/c1-2-6-4-8-5-7(6)9-3-1/h6-9H,1-5H2/t6-,7+/m0/s1 |
| InChIKey | KSCPLKVBWDOSAI-NKWVEPMBSA-N |
| SMILES | [C@@]12([H])CNC[C@]1([H])CCCN2 |
| CAS DataBase Reference | 151213-40-0(CAS DataBase Reference) |
Description and Uses
Moxifloxacin intermediate
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H318 |
| Precautionary statements | P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P310-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 41 |
| Safety Statements | 26 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | WGK 2 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 |

![(1S,6S)-2,8-Diazabicyclo[4.3.0]nonane](https://img.chemicalbook.com/CAS/GIF/151213-40-0.gif)

![cis-Octahydro-1H-pyrrolo[3,4-b]pyridine](https://img.chemicalbook.com/CAS/GIF/147459-51-6.gif)
![(4aS,7aS)-1-methyloctahydro-1H-pyrrolo[3,4-b]pyridine](https://img.chemicalbook.com/CAS/20180629/GIF/CB03345928.gif)


![6-cyclopropyl-8,9-difluoro-7-methoxy-4-oxo-4,6-dihydro-2H-1l3-[1,3]dioxino[5,6-c]quinoline-2,2-diyl diacetate](https://img.chemicalbook.com/CAS/20180702/GIF/139693-52-0.gif)