A3306312
1,3-Dimethyluracil , 99% , 874-14-6
Synonym(s):
1,3-Dimethyl-2,4(1H,3H)-pyrimidinedione;2,4-Dihydroxy-1,3-dimethylpyrimidine
CAS NO.：874-14-6
Empirical Formula: C6H8N2O2
Molecular Weight: 140.14
MDL number: MFCD00038065
EINECS: 212-856-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB18.40 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB66.40 | In Stock |
|
| 100g | RMB235.20 | In Stock |
|
| 500g | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-122 °C (lit.) |
| Boiling point: | 256.63°C (rough estimate) |
| Density | 1.2850 (rough estimate) |
| refractive index | 1.5010 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -2.04±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | almost transparency |
| BRN | 124074 |
| InChI | InChI=1S/C6H8N2O2/c1-7-4-3-5(9)8(2)6(7)10/h3-4H,1-2H3 |
| InChIKey | JSDBKAHWADVXFU-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C)C=CC(=O)N1C |
| CAS DataBase Reference | 874-14-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl-(874-14-6) |
| EPA Substance Registry System | 2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl- (874-14-6) |
Description and Uses
1,3-Dimethyluracil is suitable reagent used to investigate the steady-state absorption and fluorescence spectra of uracil derivatives. It may be used in the preparation of 2,6-dihydroxynicotinamide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi |
| Risk Statements | 36-36/37/38 |
| Safety Statements | 22-24/25-39-26-36/37 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29335990 |
