A3307212
2,5-Difluoropyridine , 98% , 84476-99-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB28.00 | In Stock |
|
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB146.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -33°C(lit.) |
| Boiling point: | 115°C(lit.) |
| Density | 1.274 g/mL at 25 °C |
| refractive index | 1.4440 |
| Flash point: | 24℃ |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| pka | -2.85±0.10(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C5H3F2N/c6-4-1-2-5(7)8-3-4/h1-3H |
| InChIKey | XFAMUOYNXFXQTC-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=C(F)C=C1 |
| CAS DataBase Reference | 84476-99-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | T,F,Xi,Xn |
| Risk Statements | 10-36/37/38-22 |
| Safety Statements | 16-26-36/37/39-37 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | 3 |
| HazardClass | IRRITANT, FLAMMABLE |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








