PRODUCT Properties
| Boiling point: | 125-126°C |
| Density | 1.265 g/mL at 25 °C |
| refractive index | n20/D 1.427 |
| Flash point: | 125-126°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Chloroform, Methanol |
| form | clear liquid |
| pka | -2.85±0.10(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C5H3F2N/c6-4-2-1-3-8-5(4)7/h1-3H |
| InChIKey | OGVLEPMNNPZAPS-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=CC=C1F |
| CAS DataBase Reference | 1513-66-2(CAS DataBase Reference) |
Description and Uses
2,3-Difluoropyridine is an intermediate used in the preparation of 2,7-diazaspiro[4.5]decan-1-one derivatives as 11-b hydroxysteroid dehydrogenase type 1 inhibitors and mineralocorticoid receptor antagonists.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H226-H302-H318-H400 |
| Precautionary statements | P210-P233-P273-P280-P301+P312-P305+P351+P338 |
| Hazard Codes | T,F,Xi,N,Xn |
| Risk Statements | 10-36/37/38-50-41-22 |
| Safety Statements | 26-36/37/39-36/37-61-45-25-16 |
| RIDADR | 1993 |
| WGK Germany | 2 |
| Hazard Note | Toxic |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 Flam. Liq. 3 |










