A3308012
1,2-Dibromo-4,5-dimethylbenzene , 98%(GC) , 24932-48-7
Synonym(s):
4,5-Dibromo-o-xylene
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB72.80 | In Stock |
|
| 25G | RMB253.60 | In Stock |
|
| 100G | RMB912.80 | In Stock |
|
| 500g | RMB4048.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-89 °C (lit.) |
| Boiling point: | 278 °C |
| Density | 1.7485 (rough estimate) |
| refractive index | 1.6146 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Yellow |
| BRN | 2206183 |
| InChI | InChI=1S/C8H8Br2/c1-5-3-7(9)8(10)4-6(5)2/h3-4H,1-2H3 |
| InChIKey | BCIDDURGCAHERU-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C)=C(C)C=C1Br |
| CAS DataBase Reference | 24932-48-7(CAS DataBase Reference) |
Description and Uses
1,2-Dibromo-4,5-dimethylbenzene can be used in the synthesis of alkylamino zinc(II)phthalocyanines, with potential application as photosensitizers in photodynamic therapy. It can also be used in the synthesis of 1,2-dibromo-4,5-bis(dibromomethyl)benzene via reaction with azobisisobutyronitrile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







