A3308212
Diethyl chloromalonate , 95% , 14064-10-9
CAS NO.:14064-10-9
Empirical Formula: C7H11ClO4
Molecular Weight: 194.61
MDL number: MFCD00009140
EINECS: 237-913-0
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB68.80 | In Stock |
|
| 25ML | RMB288.00 | In Stock |
|
| 100ML | RMB1015.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 279.11°C (rough estimate) |
| Density | 1.204 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 9.07±0.46(Predicted) |
| Specific Gravity | 1.204 |
| color | Clear colorless |
| InChI | InChI=1S/C7H11ClO4/c1-3-11-6(9)5(8)7(10)12-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | WLWCQKMQYZFTDR-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Cl)C(OCC)=O |
| LogP | 2.23 at 40℃ and pH4-9 |
| CAS DataBase Reference | 14064-10-9(CAS DataBase Reference) |
| EPA Substance Registry System | Propanedioic acid, 2-chloro-, 1,3-diethyl ester (14064-10-9) |
Description and Uses
A compound used in the models of aquatic toxicity developed (QSAR). Combinatorial QSAR modeling of chemical toxicants tested against Tetrahymena pyriformis.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H314-H335-H400 |
| Precautionary statements | P261-P271-P273-P280-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







![5-(2-Methoxyphenoxy)-[2,2'-bipyrimidine]-4,6[1H,5H]-dione](https://img.chemicalbook.com/CAS/GIF/150728-12-4.gif)
