A3310312
(3S)-(-)-3-(Dimethylamino)pyrrolidine , ≥97.0%(GC) , 132883-44-4
Synonym(s):
(3S)-N,N-Dimethyl-3-pyrrolidinamine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB204.80 | In Stock |
|
| 1G | RMB559.20 | In Stock |
|
| 5G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 160 °C/760 mmHg (lit.) |
| Density | 0.899 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | 9.93±0.10(Predicted) |
| color | Colorless to Light yellow |
| Specific Gravity | 0.90 |
| optical activity | [α]/D 14±2°, c = 1 in ethanol |
| InChI | InChI=1S/C6H14N2/c1-8(2)6-3-4-7-5-6/h6-7H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | AVAWMINJNRAQFS-LURJTMIESA-N |
| SMILES | N1CC[C@H](N(C)C)C1 |
| CAS DataBase Reference | 132883-44-4(CAS DataBase Reference) |
Description and Uses
(S)-()-3-(Dimethylamino)pyrrolidine can be used as a reactant in the syntheses of oxadiazolylthiazole and xanthone derivatives of biological importance.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302-H315-H318-H335 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 10-22-37/38-41-38-37 |
| Safety Statements | 26-39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2933998090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








![2-(4-CHLOROBENZYL)-2,5-DIAZA-BICYCLO[2.2.1]HEPTANE](https://img.chemicalbook.com/CAS/GIF/845866-65-1.gif)