Dapagliflozin , ≥99% , 461432-26-8
CAS NO.:461432-26-8
Empirical Formula: C21H25ClO6
Molecular Weight: 408.88
MDL number: MFCD13182359
EINECS: 639-683-0
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB23.20 | In Stock |
|
| 50MG | RMB47.20 | In Stock |
|
| 250mg | RMB143.20 | In Stock |
|
| 1g | RMB389.60 | In Stock |
|
| 5G | RMB1119.20 | In Stock |
|
| 25g | RMB3648.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 55-58°C |
| Boiling point: | 609.0±55.0 °C(Predicted) |
| Density | 1.349 |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 13.23±0.70(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| optical activity | [α]/D (+7.0° to +13.0°, c = 0.2 in methanol) |
| Stability: | Hygroscopic |
| InChI | 1S/C21H25ClO6/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-8,10,17-21,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | JVHXJTBJCFBINQ-JNTNYNDRNA-N |
| SMILES | O[C@@H]1[C@H]([C@H](O)[C@@H](CO)O[C@H]1C1C=CC(Cl)=C(CC2C=CC(OCC)=CC=2)C=1)O |&1:1,2,3,5,9,r| |
Description and Uses
Inhibiting renal glucose reabsorbtion through the sodium-
therapeutic for diabetes I or II, and hyperglycemia
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H302-H372-H318 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P260-P264-P270-P314-P501-P280-P305+P351+P338-P310 |
| target organs | Kidney |
| RIDADR | UN3077 |
| WGK Germany | WGK 3 |
| HazardClass | 9 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 STOT RE 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |









