A3321512
(Dimethylamino)acetaldehyde Diethyl Acetal , ≥95.0% , 3616-56-6
Synonym(s):
2,2-Diethoxy-N,N-dimethylethylamine
CAS NO.:3616-56-6
Empirical Formula: C8H19NO2
Molecular Weight: 161.24
MDL number: MFCD00009232
EINECS: 222-800-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB199.20 | In Stock |
|
| 500g | RMB711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 170 °C (lit.) |
| Density | 0.883 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 113 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| pka | 9.35±0.28(Predicted) |
| color | Colorless to Almost colorless |
| BRN | 1739149 |
| InChI | InChI=1S/C8H19NO2/c1-5-10-8(11-6-2)7-9(3)4/h8H,5-7H2,1-4H3 |
| InChIKey | SSFAUOAQOOISRQ-UHFFFAOYSA-N |
| SMILES | C(N(C)C)C(OCC)OCC |
| CAS DataBase Reference | 3616-56-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanamine, 2,2-diethoxy-N,N-dimethyl-(3616-56-6) |
Description and Uses
Dimethylaminoacetaldehyde Diethyl Acetal is used in the preparation of biindoles via copper-mediated regioselective dehydrogenative homocoupling of N-pyrimidyl indoles.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29221990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








