A3323612
Disodium Cromoglycate , ≥99% , 15826-37-6
Synonym(s):
Cromoglycate;Cromoglycic acid;Cromolyn sodium salt
CAS NO.:15826-37-6
Empirical Formula: C23H14O11.2Na
Molecular Weight: 512.33
MDL number: MFCD00057744
EINECS: 239-926-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB194.40 | In Stock |
|
| 25G | RMB680.80 | In Stock |
|
| 100g | RMB2150.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241-2420C (dec) |
| storage temp. | 2-8°C |
| solubility | Soluble in water, practically insoluble in ethanol (96 per cent). |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water to 100mg/ml |
| Merck | 14,2590 |
| Stability: | Hygroscopyc |
| Cosmetics Ingredients Functions | ANTI-SEBUM |
| InChIKey | VLARUOGDXDTHEH-UHFFFAOYSA-L |
| SMILES | O(C1C=CC=C2OC(C(=O)O)=CC(=O)C=12)CC(O)COC1C=CC=C2OC(C(=O)O)=CC(=O)C=12.[NaH] |
| CAS DataBase Reference | 15826-37-6(CAS DataBase Reference) |
Description and Uses
Disodium cromoglycateis a relatively nontoxic agent used for the long-term prevention of many types of asthma. It has no bronchodilator properties and is used in the prophylaxis of asthma. It does not play a role in the treatment of acute asthmatic attacks including severe asthma.
Anti Asthamatic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3249 |
| WGK Germany | 2 |
| RTECS | DJ2380000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29329990 |
| Toxicity | LD50 in mice, rats (mg/kg): >8000 orally (Cox) |



