A3324312
Diclofenac Diethylamine , ≥99% , 78213-16-8
CAS NO.:78213-16-8
Empirical Formula: C18H22Cl2N2O2
Molecular Weight: 369.29
MDL number: MFCD01862249
EINECS: 616-599-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB56.00 | In Stock |
|
| 25G | RMB213.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-148°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 30 mg/ml; DMSO: 10 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 2 mg/ml |
| form | A crystalline solid |
| color | White to off-white |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | InChI=1S/C14H11Cl2NO2.C4H11N/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;1-3-5-4-2/h1-7,17H,8H2,(H,18,19);5H,3-4H2,1-2H3 |
| InChIKey | ZQVZPANTCLRASL-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1CC(=O)O)NC1C(Cl)=CC=CC=1Cl.N(CC)CC |
| CAS DataBase Reference | 78213-16-8(CAS DataBase Reference) |
Description and Uses
Diclofenac diethylamine is a nonsteroidal anti-inflammatory drug taken to reduce inflammation and as an analgesic reducing pain in certain conditions.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H335-H319-H311-H301-H315 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P280-P302+P352-P312-P322-P361-P363-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |







