A3325212
Ethacridine lactate monohydrate , ≥99% , 6402-23-9
Synonym(s):
Acrinol;Ethacridine lactate salt;Ethodin
CAS NO.:6402-23-9
Empirical Formula: C18H21N3O4
Molecular Weight: 343.38
MDL number: MFCD00013149
EINECS: 642-272-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB37.60 | In Stock |
|
| 5g | RMB112.80 | In Stock |
|
| 25G | RMB325.60 | In Stock |
|
| 100G | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-245 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Sparingly soluble in water, very slightly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. |
| form | Powder |
| color | Yellow |
| Merck | 14,3716 |
| BRN | 3642805 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) |
| InChIKey | IYLLULUTZPKQBW-UHFFFAOYSA-N |
| SMILES | C(O)(C)C(=O)O.NC1C2=CC=C(N)C=C2N=C2C=CC(OCC)=CC=12 |
| CAS DataBase Reference | 6402-23-9(CAS DataBase Reference) |
Description and Uses
Reagent in serological testing and protein chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | OD4725000 |
| HS Code | 29339980 |
| Toxicity | LD50 s.c. in mice: 0.12 g/kg (Rubbo) |





