A3329012
Disperse Blue 1 , Dyecontent30% , 2475-45-8
Synonym(s):
1,4,5,8-Tetraaminoanthraquinone
CAS NO.：2475-45-8
Empirical Formula: C14H12N4O2
Molecular Weight: 268.27
MDL number: MFCD00001225
EINECS: 219-603-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB79.20 | In Stock |
|
| 1G | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 332℃ |
| Boiling point: | 411.44°C (rough estimate) |
| Density | 1.2035 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | room temp |
| solubility | 1 M NH4OH: 10mg/mL, opaque, blue |
| form | Powder |
| pka | 0.40±0.20(Predicted) |
| Colour Index | 64500 |
| color | Chocolate brown |
| Water Solubility | 26.83ug/L(25 ºC) |
| λmax | 607 nm |
| BRN | 925672 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions | HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | DISPERSE BLUE 1 (2475-45-8) |
| InChI | 1S/C14H12N4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H,15-18H2 |
| InChIKey | JSFUMBWFPQSADC-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N)c2C(=O)c3c(N)ccc(N)c3C(=O)c12 |
| CAS DataBase Reference | 2475-45-8(CAS DataBase Reference) |
| IARC | 2B (Vol. 48) 1990 |
| EPA Substance Registry System | C.I. Disperse Blue 1 (2475-45-8) |
Description and Uses
Disperse Blue 1 is a textile disperse dye. It is an anthraquinone dye used at low levels in semipermanent hair color formulations. Dyes and metabolites, Environmental Testing.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H318-H350 |
| Precautionary statements | P201-P280-P302+P352-P305+P351+P338+P310-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 45-38-41-43 |
| Safety Statements | 53-45 |
| WGK Germany | 3 |
| RTECS | CB0540000 |
| TSCA | TSCA listed |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 2475-45-8(Hazardous Substances Data) |
